Difference between revisions of "PWY-7909"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P3 DIHYDRONEOPTERIN-P3] ==
+== Pathway PWY-7909 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 7,8-dihydroneopterin 3'-triphosphate
+** formaldehyde oxidation vii (thf pathway)
-* smiles:
+== Reaction(s) found ==
-** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
+* [[FORMYLTHFDEFORMYL-RXN]]
-* inchi-key:
+* [[METHENYLTHFCYCLOHYDRO-RXN]]
-** dgguvlxvlhaagt-xinawcovsa-j
+* [[METHYLENETHFDEHYDROG-NADP-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 491.141
+* [NoneRXN-2881 RXN-2881]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[4.2.3.12-RXN]]
+{{#set: common-name=formaldehyde oxidation vii (thf pathway)}}
-* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
+{{#set: nb reaction found=3}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.75}}
-* [[GTP-CYCLOHYDRO-I-RXN]]
+{{#set: nb total reaction=4}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}}
-{{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}}
-{{#set: molecular-weight=491.141}}