Difference between revisions of "PWY-7917"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUPER-OXIDE SUPER-OXIDE] == * common-name: ** superoxide * smiles: ** [o-]o * inchi-key: ** ouu...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] == * common-name: ** oxaloacetate * smiles: ** c(c([o-])=o)c(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUPER-OXIDE SUPER-OXIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] ==
 
* common-name:
 
* common-name:
** superoxide
+
** oxaloacetate
 
* smiles:
 
* smiles:
** [o-]o
+
** c(c([o-])=o)c(=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** ouuqczgpvncoij-uhfffaoysa-m
+
** khpxuqmniqbqev-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 31.999
+
** 130.057
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SUPEROX-DISMUT-RXN]]
+
* [[ASPAMINOTRANS-RXN]]
 +
* [[CITSYN-RXN]]
 +
* [[CSm]]
 +
* [[MALATE-DEH-RXN]]
 +
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[OAAAKGtm]]
 +
* [[OAACITtm]]
 +
* [[OXALODECARB-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN-2464]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12615]]
+
* [[ASPAMINOTRANS-RXN]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[ATPCL]]
 +
* [[MALATE-DEH-RXN]]
 +
* [[OAAAKGtm]]
 +
* [[OAACITtm]]
 +
* [[OXALOACETATE-TAUTOMERASE-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOX-RXN]]
 +
* [[PPC]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN-2464]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=superoxide}}
+
{{#set: common-name=oxaloacetate}}
{{#set: inchi-key=inchikey=ouuqczgpvncoij-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
{{#set: molecular-weight=31.999}}
+
{{#set: molecular-weight=130.057}}

Revision as of 09:22, 27 August 2019