Difference between revisions of "PWY-7918"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] ==
+== Pathway PWY-7573 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** prephenate
+** gdp-mycosamine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1)
+* [[GDPMANDEHYDRA-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** fpwmcupfbrfmlh-xgaoumnusa-l
+* [NoneRXN-15969 RXN-15969]
-* molecular-weight:
+* [NoneRXN-15970 RXN-15970]
-** 224.17
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=gdp-mycosamine biosynthesis}}
-* [[CHORISMATEMUT-RXN]]
+{{#set: nb reaction found=1}}
-* [[PPDH]]
+{{#set: completion rate=0.33}}
-* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
+{{#set: nb total reaction=3}}
-* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
-* [[PREPHENATE-TRANSAMINE-RXN]]
-* [[PREPHENATEDEHYDRAT-RXN]]
-* [[PREPHENATEDEHYDROG-RXN]]
-== Reaction(s) known to produce the compound ==
-* [[CHORISMATEMUT-RXN]]
-* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
-* [[PREPHENATE-TRANSAMINE-RXN]]
-* [[PREPHENATEDEHYDRAT-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=prephenate}}
-{{#set: inchi-key=inchikey=fpwmcupfbrfmlh-xgaoumnusa-l}}
-{{#set: molecular-weight=224.17}}