Difference between revisions of "PWY-7921"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * common-name: ** γ-l-glutamyl-glycylglycine * smiles: ** c(nc(cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-TRIMETHYLAMMONIOBUTANAL 4-TRIMETHYLAMMONIOBUTANAL] == * common-name: ** 4-trimethylammoniobut...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-TRIMETHYLAMMONIOBUTANAL 4-TRIMETHYLAMMONIOBUTANAL] ==
 
* common-name:
 
* common-name:
** γ-l-glutamyl-glycylglycine
+
** 4-trimethylammoniobutanal
 
* smiles:
 
* smiles:
** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o
+
** c(cc[ch]=o)[n+](c)(c)c
 
* inchi-key:
 
* inchi-key:
** rwazieyjawtklb-yfkpbyrvsa-m
+
** oitblcdwxsxncn-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 260.226
+
** 130.209
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18092]]
+
* [[RXN-9896]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-l-glutamyl-glycylglycine}}
+
{{#set: common-name=4-trimethylammoniobutanal}}
{{#set: inchi-key=inchikey=rwazieyjawtklb-yfkpbyrvsa-m}}
+
{{#set: inchi-key=inchikey=oitblcdwxsxncn-uhfffaoysa-n}}
{{#set: molecular-weight=260.226}}
+
{{#set: molecular-weight=130.209}}

Revision as of 09:22, 27 August 2019

Metabolite 4-TRIMETHYLAMMONIOBUTANAL

  • common-name:
    • 4-trimethylammoniobutanal
  • smiles:
    • c(cc[ch]=o)[n+](c)(c)c
  • inchi-key:
    • oitblcdwxsxncn-uhfffaoysa-n
  • molecular-weight:
    • 130.209

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality