Difference between revisions of "PWY-7922"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] ==
+== Pathway PWY-7922 ==
+* taxonomic-range:
+** tax-33208
 * common-name:
-** (s)-equol
+** protein o-mannosylation ii (mammals)
-* smiles:
+== Reaction(s) found ==
-** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o)
+* [[2.4.1.109-RXN]]
-* inchi-key:
+* [[2.4.1.83-RXN]]
-** adfcqwzhkcxpaj-gfccvegcsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-18948 RXN-18948]
-** 242.274
+* [NoneRXN-16594 RXN-16594]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18949 RXN-18949]
-* [[RXN-15589]]
+{{#set: taxonomic-range=tax-33208}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=protein o-mannosylation ii (mammals)}}
-* [[RXN-15589]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.4}}
-{{#set: common-name=(s)-equol}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=adfcqwzhkcxpaj-gfccvegcsa-n}}
-{{#set: molecular-weight=242.274}}