Difference between revisions of "PWY-7939"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] ==
+== Pathway PWY-7939 ==
+* taxonomic-range:
+** tax-191412
 * common-name:
-** dioleoyl phosphatidate
+** chlorobactene biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
+* [[RXN1F-150]]
-* inchi-key:
+== Reaction(s) not found ==
-** mhuwzntuiifhas-dssvuwshsa-l
+* [NoneRXN-19135 RXN-19135]
-* molecular-weight:
+{{#set: taxonomic-range=tax-191412}}
-** 698.959
+{{#set: common-name=chlorobactene biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-15068]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[RXN-15043]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=dioleoyl phosphatidate}}
-{{#set: inchi-key=inchikey=mhuwzntuiifhas-dssvuwshsa-l}}
-{{#set: molecular-weight=698.959}}