Difference between revisions of "PWY-7939"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:reaction reconstruction category::orthology | ?common-name | ?ec-number | ?reconstruction tool | ?reconstruction source | ?reconstruction comment | ?n...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * common-name: ** dioleoyl phosphatidate * smiles: ** ccccccccc=ccccccccc...") |
||
| Line 1: | Line 1: | ||
| − | + | [[Category:metabolite]] | |
| − | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == | |
| − | + | * common-name: | |
| − | + | ** dioleoyl phosphatidate | |
| − | + | * smiles: | |
| − | + | ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o | |
| − | + | * inchi-key: | |
| − | + | ** mhuwzntuiifhas-dssvuwshsa-l | |
| − | }} | + | * molecular-weight: |
| + | ** 698.959 | ||
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15068]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15043]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=dioleoyl phosphatidate}} | ||
| + | {{#set: inchi-key=inchikey=mhuwzntuiifhas-dssvuwshsa-l}} | ||
| + | {{#set: molecular-weight=698.959}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-8268
- common-name:
- dioleoyl phosphatidate
- smiles:
- ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
- inchi-key:
- mhuwzntuiifhas-dssvuwshsa-l
- molecular-weight:
- 698.959
