Difference between revisions of "PWY-7942"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10792 CPD-10792] == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19072 CPD-19072] == * common-name: ** (25s)-3β-hydroxycholest-5-en-26-oate * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10792 CPD-10792] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19072 CPD-19072] ==
 
* common-name:
 
* common-name:
** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
+
** (25s)-3β-hydroxycholest-5-en-26-oate
 
* smiles:
 
* smiles:
** cc(=o)c(o)c(o)cc([n+])c([o-])=o
+
** cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** ifmhgoadxgywmo-kvqbguixsa-n
+
** wvxomprlwlxfap-ddmwtqrysa-m
 
* molecular-weight:
 
* molecular-weight:
** 191.183
+
** 415.635
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10032]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12701]]
 +
* [[RXN-17654]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}}
+
{{#set: common-name=(25s)-3β-hydroxycholest-5-en-26-oate}}
{{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}}
+
{{#set: inchi-key=inchikey=wvxomprlwlxfap-ddmwtqrysa-m}}
{{#set: molecular-weight=191.183}}
+
{{#set: molecular-weight=415.635}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-19072

  • common-name:
    • (25s)-3β-hydroxycholest-5-en-26-oate
  • smiles:
    • cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • wvxomprlwlxfap-ddmwtqrysa-m
  • molecular-weight:
    • 415.635

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality