Difference between revisions of "PWY-7948"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S2O3 S2O3] == * common-name: ** thiosulfate * smiles: ** o=s(=o)([o-])s * inchi-key: ** dhcdfwk...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == * common-name: ** β-d-fructose 1,6-bis...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-fructose 1,6-bisphosphate |
* smiles: | * smiles: | ||
| − | ** o | + | ** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rnbgygvwrkecfj-arqdhwqxsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 336.085 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.1.90-RXN]] |
| − | * [[ | + | * [[F16ALDOLASE-RXN]] |
| + | * [[F16BDEPHOS-RXN]] | ||
| + | * [[FBA_]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.1.90-RXN]] |
| + | * [[6PFRUCTPHOS-RXN]] | ||
| + | * [[F16ALDOLASE-RXN]] | ||
| + | * [[FBA_]] | ||
| + | * [[PFK_]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-fructose 1,6-bisphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=336.085}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite FRUCTOSE-16-DIPHOSPHATE
- common-name:
- β-d-fructose 1,6-bisphosphate
- smiles:
- c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
- inchi-key:
- rnbgygvwrkecfj-arqdhwqxsa-j
- molecular-weight:
- 336.085
