Difference between revisions of "PWY-7949"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * common-name: ** n-acetyl-serotonin sulfate * smiles: ** cc(=o)nccc1(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17757 CPD-17757] == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17757 CPD-17757] ==
 
* common-name:
 
* common-name:
** n-acetyl-serotonin sulfate
+
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate
 
* smiles:
 
* smiles:
** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
+
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
 
* inchi-key:
 
* inchi-key:
** ucajznvfrvluls-uhfffaoysa-m
+
** bujztfindcqrgp-zdlrkiohsa-l
 
* molecular-weight:
 
* molecular-weight:
** 297.305
+
** 457.362
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16512]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11059]]
+
* [[RXN-16512]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-serotonin sulfate}}
+
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate}}
{{#set: inchi-key=inchikey=ucajznvfrvluls-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=bujztfindcqrgp-zdlrkiohsa-l}}
{{#set: molecular-weight=297.305}}
+
{{#set: molecular-weight=457.362}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-17757

  • common-name:
    • 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate
  • smiles:
    • cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
  • inchi-key:
    • bujztfindcqrgp-zdlrkiohsa-l
  • molecular-weight:
    • 457.362

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality