Difference between revisions of "PWY-7962"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-COCLAURINE S-COCLAURINE] == * common-name: ** (s)-coclaurine * smiles: ** c1([n+][ch](c2(c(c1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * common-name: ** (2s)-liquiritigenin * smiles: ** c1(c=c(c=cc=1c3(oc2(=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (2s)-liquiritigenin |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** furuxtvzlhccna-aweznqclsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.257 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-3221]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(2s)-liquiritigenin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=furuxtvzlhccna-aweznqclsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.257}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-3061
- common-name:
- (2s)-liquiritigenin
- smiles:
- c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o)
- inchi-key:
- furuxtvzlhccna-aweznqclsa-n
- molecular-weight:
- 256.257
