Difference between revisions of "PWY-8191"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] == * common-name: ** demethylmenaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)...")
(Created page with "Category:pathway == Pathway PWY-8191 == == Reaction(s) found == * RXN-11876 * RXN-11878 * RXN-11887 * RXN-21830 * RXN-21831 * RXN-21833 * RXN-218...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] ==
+
== Pathway PWY-8191 ==
* common-name:
+
== Reaction(s) found ==
** demethylmenaquinol-6
+
* [[RXN-11876]]
* smiles:
+
* [[RXN-11878]]
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+
* [[RXN-11887]]
* inchi-key:
+
* [[RXN-21830]]
** ufaxpzazhzpelj-rotsudqpsa-n
+
* [[RXN-21831]]
* molecular-weight:
+
* [[RXN-21833]]
** 568.881
+
* [[RXN-21834]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-21835]]
* [[RXN-9220]]
+
* [[RXN21165]]
== Reaction(s) known to produce the compound ==
+
* [[RXN21166]]
== Reaction(s) of unknown directionality ==
+
* [[RXN21167]]
{{#set: common-name=demethylmenaquinol-6}}
+
== Reaction(s) not found ==
{{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}}
+
* [NoneRXN-21826 RXN-21826]
{{#set: molecular-weight=568.881}}
+
* [NoneRXN-21837 RXN-21837]
 +
* [NoneRXN66-28 RXN66-28]
 +
* [NoneRXN-21165 RXN-21165]
 +
* [NoneRXN-21167 RXN-21167]
 +
* [NoneRXN-21827 RXN-21827]
 +
* [NoneRXN-21828 RXN-21828]
 +
* [NoneRXN-11884 RXN-11884]
 +
* [NoneRXN-11959 RXN-11959]
 +
* [NoneRXN-21166 RXN-21166]
 +
* [NoneRXN66-27 RXN66-27]
 +
{{#set: nb reaction found=11}}
 +
{{#set: completion rate=0.58}}
 +
{{#set: nb total reaction=19}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-8191

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-21826 RXN-21826]
  • [NoneRXN-21837 RXN-21837]
  • [NoneRXN66-28 RXN66-28]
  • [NoneRXN-21165 RXN-21165]
  • [NoneRXN-21167 RXN-21167]
  • [NoneRXN-21827 RXN-21827]
  • [NoneRXN-21828 RXN-21828]
  • [NoneRXN-11884 RXN-11884]
  • [NoneRXN-11959 RXN-11959]
  • [NoneRXN-21166 RXN-21166]
  • [NoneRXN66-27 RXN66-27]