Difference between revisions of "PWY-8191"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] == * common-name: ** demethylmenaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * common-name: ** dehydro-d-arabinono-1,4-lactone * smiles: ** c(o)c1(c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-6
+
** dehydro-d-arabinono-1,4-lactone
 
* smiles:
 
* smiles:
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+
** c(o)c1(c(o)=c(o)c(=o)o1)
 
* inchi-key:
 
* inchi-key:
** ufaxpzazhzpelj-rotsudqpsa-n
+
** zzzcuofihgpkak-uwtatzphsa-n
 
* molecular-weight:
 
* molecular-weight:
** 568.881
+
** 146.099
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9220]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.3.37-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-6}}
+
{{#set: common-name=dehydro-d-arabinono-1,4-lactone}}
{{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}}
+
{{#set: inchi-key=inchikey=zzzcuofihgpkak-uwtatzphsa-n}}
{{#set: molecular-weight=568.881}}
+
{{#set: molecular-weight=146.099}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-1789

  • common-name:
    • dehydro-d-arabinono-1,4-lactone
  • smiles:
    • c(o)c1(c(o)=c(o)c(=o)o1)
  • inchi-key:
    • zzzcuofihgpkak-uwtatzphsa-n
  • molecular-weight:
    • 146.099

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality