Difference between revisions of "PWY-922"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * common-name: ** 2-phospho-d-glycerate * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-adenine1518-adenine1519 16S-rRNA-adenine1518-adenine1519] == * common-name: ** adenine...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-adenine1518-adenine1519 16S-rRNA-adenine1518-adenine1519] ==
 
* common-name:
 
* common-name:
** 2-phospho-d-glycerate
+
** adenine1518/adenine1519 in 16s rrna
* smiles:
 
** c(=o)([o-])c(op(=o)([o-])[o-])co
 
* inchi-key:
 
** gxiurptvhjpjlf-uwtatzphsa-k
 
* molecular-weight:
 
** 183.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2PGADEHYDRAT-RXN]]
+
* [[RXN-11633]]
* [[3PGAREARR-RXN]]
 
* [[RXN-15510]]
 
* [[RXN-15513]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2PGADEHYDRAT-RXN]]
 
* [[3PGAREARR-RXN]]
 
* [[RXN-15510]]
 
* [[RXN-15513]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-phospho-d-glycerate}}
+
{{#set: common-name=adenine1518/adenine1519 in 16s rrna}}
{{#set: inchi-key=inchikey=gxiurptvhjpjlf-uwtatzphsa-k}}
 
{{#set: molecular-weight=183.034}}
 

Revision as of 14:19, 26 August 2019

Metabolite 16S-rRNA-adenine1518-adenine1519

  • common-name:
    • adenine1518/adenine1519 in 16s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality