Difference between revisions of "PWY-I9"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * common-name: ** 5-hydroxyindole acetate *...")
 
(Created page with "Category:pathway == Pathway PWY-I9 == * taxonomic-range: ** tax-2 * common-name: ** l-cysteine biosynthesis vi (from l-methionine) == Reaction(s) found == * ADENOSYLHOMO...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] ==
+
== Pathway PWY-I9 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 5-hydroxyindole acetate
+
** l-cysteine biosynthesis vi (from l-methionine)
* smiles:
+
== Reaction(s) found ==
** c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-]))
+
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
* inchi-key:
+
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
** duugkqcegzlzno-uhfffaoysa-m
+
* [[O-SUCCHOMOSERLYASE-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 190.178
+
* [NoneRIBOSYLHOMOCYSTEINASE-RXN RIBOSYLHOMOCYSTEINASE-RXN]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-7605 RXN-7605]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-2}}
* [[RXN-10780]]
+
{{#set: common-name=l-cysteine biosynthesis vi (from l-methionine)}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=3}}
{{#set: common-name=5-hydroxyindole acetate}}
+
{{#set: completion rate=0.6}}
{{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}}
+
{{#set: nb total reaction=5}}
{{#set: molecular-weight=190.178}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-I9

  • taxonomic-range:
    • tax-2
  • common-name:
    • l-cysteine biosynthesis vi (from l-methionine)

Reaction(s) found

Reaction(s) not found

  • [NoneRIBOSYLHOMOCYSTEINASE-RXN RIBOSYLHOMOCYSTEINASE-RXN]
  • [NoneRXN-7605 RXN-7605]