Difference between revisions of "PWY0-1021"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17757 CPD-17757] == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-...")
(Created page with "Category:pathway == Pathway PWY0-1021 == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** l-alanine biosynthesis iii == Reaction(s) found == * RXN0-308 == Rea...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17757 CPD-17757] ==
+
== Pathway PWY0-1021 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate
+
** l-alanine biosynthesis iii
* smiles:
+
== Reaction(s) found ==
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
+
* [[RXN0-308]]
* inchi-key:
+
== Reaction(s) not found ==
** bujztfindcqrgp-zdlrkiohsa-l
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-2|tax-2759}}
** 457.362
+
{{#set: common-name=l-alanine biosynthesis iii}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-16512]]
+
{{#set: completion rate=1.0}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=1}}
* [[RXN-16512]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate}}
 
{{#set: inchi-key=inchikey=bujztfindcqrgp-zdlrkiohsa-l}}
 
{{#set: molecular-weight=457.362}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY0-1021

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • l-alanine biosynthesis iii

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present