Difference between revisions of "PWY0-1182"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] == * common-name: ** 1,2-dioleoylglycerol * smiles: ** ccccccccc=ccccccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-myristoyl-ACPs 3-oxo-myristoyl-ACPs] == * common-name: ** a 3-oxo-myristoyl-[acp] == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-myristoyl-ACPs 3-oxo-myristoyl-ACPs] ==
 
* common-name:
 
* common-name:
** 1,2-dioleoylglycerol
+
** a 3-oxo-myristoyl-[acp]
* smiles:
 
** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o
 
* inchi-key:
 
** afshuzfnmvjnkx-llwmboqksa-n
 
* molecular-weight:
 
** 620.995
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9536]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15090]]
+
* [[RXN-9535]]
 +
* [[RXN-9653]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,2-dioleoylglycerol}}
+
{{#set: common-name=a 3-oxo-myristoyl-[acp]}}
{{#set: inchi-key=inchikey=afshuzfnmvjnkx-llwmboqksa-n}}
 
{{#set: molecular-weight=620.995}}
 

Revision as of 14:18, 26 August 2019

Metabolite 3-oxo-myristoyl-ACPs

  • common-name:
    • a 3-oxo-myristoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-myristoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.