Difference between revisions of "PWY0-1264"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3725 CPD-3725] == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2184 CPD0-2184] == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioat...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2184 CPD0-2184] == |
* common-name: | * common-name: | ||
− | ** | + | ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate |
* smiles: | * smiles: | ||
− | ** | + | ** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wcjyzufkktynlb-aritwgjrsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 210.143 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12070]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=210.143}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD0-2184
- common-name:
- (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
- smiles:
- c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
- inchi-key:
- wcjyzufkktynlb-aritwgjrsa-l
- molecular-weight:
- 210.143