Difference between revisions of "PWY0-1264"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3725 CPD-3725] == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2184 CPD0-2184] == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioat...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3725 CPD-3725] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2184 CPD0-2184] ==
 
* common-name:
 
* common-name:
** uridine 2'3'-cyclic monophosphate
+
** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
 
* smiles:
 
* smiles:
** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
+
** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** hwdmhjdymfrxox-xvfcmesisa-m
+
** wcjyzufkktynlb-aritwgjrsa-l
 
* molecular-weight:
 
* molecular-weight:
** 305.16
+
** 210.143
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12060]]
+
* [[RXN-12070]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uridine 2'3'-cyclic monophosphate}}
+
{{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}}
{{#set: inchi-key=inchikey=hwdmhjdymfrxox-xvfcmesisa-m}}
+
{{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}}
{{#set: molecular-weight=305.16}}
+
{{#set: molecular-weight=210.143}}

Revision as of 14:19, 26 August 2019

Metabolite CPD0-2184

  • common-name:
    • (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
  • smiles:
    • c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
  • inchi-key:
    • wcjyzufkktynlb-aritwgjrsa-l
  • molecular-weight:
    • 210.143

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality