Difference between revisions of "PWY0-1264"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2184 CPD0-2184] == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioat...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Beta-Hydroxysterols 3-Beta-Hydroxysterols] == * common-name: ** a 3β-hydroxysteroid == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2184 CPD0-2184] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Beta-Hydroxysterols 3-Beta-Hydroxysterols] ==
 
* common-name:
 
* common-name:
** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
+
** a 3β-hydroxysteroid
* smiles:
 
** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
 
* inchi-key:
 
** wcjyzufkktynlb-aritwgjrsa-l
 
* molecular-weight:
 
** 210.143
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12070]]
+
* [[RXN-13686]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13686]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}}
+
{{#set: common-name=a 3β-hydroxysteroid}}
{{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}}
 
{{#set: molecular-weight=210.143}}
 

Revision as of 09:22, 27 August 2019

Metabolite 3-Beta-Hydroxysterols

  • common-name:
    • a 3β-hydroxysteroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality