Difference between revisions of "PWY0-1275"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o...")
 
(Created page with "Category:pathway == Pathway PWY0-1275 == * taxonomic-range: ** tax-4751 ** tax-2 * common-name: ** lipoate biosynthesis and incorporation ii == Reaction(s) found == * RX...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] ==
+
== Pathway PWY0-1275 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-2
 
* common-name:
 
* common-name:
** 7,8-dihydromonapterin
+
** lipoate biosynthesis and incorporation ii
* smiles:
+
== Reaction(s) found ==
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
+
* [[RXN0-5098]]
* inchi-key:
+
* [[RXN0-949]]
** yqifamynggotfb-njgyiypdsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 255.233
+
{{#set: taxonomic-range=tax-4751|tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=lipoate biosynthesis and incorporation ii}}
* [[RXN-10857]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=2}}
{{#set: common-name=7,8-dihydromonapterin}}
 
{{#set: inchi-key=inchikey=yqifamynggotfb-njgyiypdsa-n}}
 
{{#set: molecular-weight=255.233}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY0-1275

  • taxonomic-range:
    • tax-4751
    • tax-2
  • common-name:
    • lipoate biosynthesis and incorporation ii

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present