Difference between revisions of "PWY0-1299"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETF-Reduced ETF-Reduced] == * common-name: ** a reduced electron-transfer flavoprotein == React...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-formylglutathione |
| + | * smiles: | ||
| + | ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** fhxagoicbfgebf-bqbzgakwsa-m | ||
| + | * molecular-weight: | ||
| + | ** 334.323 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-276]] |
| − | + | * [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]] | |
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-2962]] | |
| − | + | * [[RXN0-276]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN0- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-formylglutathione}} |
| + | {{#set: inchi-key=inchikey=fhxagoicbfgebf-bqbzgakwsa-m}} | ||
| + | {{#set: molecular-weight=334.323}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-548
- common-name:
- s-formylglutathione
- smiles:
- c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
- inchi-key:
- fhxagoicbfgebf-bqbzgakwsa-m
- molecular-weight:
- 334.323
