Difference between revisions of "PWY0-1299"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * common-name: ** dopamine 3-o-sulfate * smiles: ** c1(=c(cc[n+])c=c(os(=...")
(Created page with "Category:pathway == Pathway PWY0-1299 == * taxonomic-range: ** tax-2 * common-name: ** arginine dependent acid resistance == Reaction(s) found == * ARGDECARBOX-RXN ==...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] ==
+
== Pathway PWY0-1299 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** dopamine 3-o-sulfate
+
** arginine dependent acid resistance
* smiles:
+
== Reaction(s) found ==
** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
+
* [[ARGDECARBOX-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** nzkryjgnypyxjz-uhfffaoysa-n
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-2}}
** 233.239
+
{{#set: common-name=arginine dependent acid resistance}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=1.0}}
* [[RXN6666-9]]
+
{{#set: nb total reaction=1}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=dopamine 3-o-sulfate}}
 
{{#set: inchi-key=inchikey=nzkryjgnypyxjz-uhfffaoysa-n}}
 
{{#set: molecular-weight=233.239}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY0-1299

  • taxonomic-range:
    • tax-2
  • common-name:
    • arginine dependent acid resistance

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present