Difference between revisions of "PWY0-1301"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] ==
 * common-name:
-** l-ascorbate
+** cyclic-gmp
 * smiles:
-** c(o)c(o)[ch]1(c([o-])=c(o)c(=o)o1)
+** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-]))
 * inchi-key:
-** ciwbshskhkdkbq-jlaznsocsa-m
+** zoogrgpoevqqdx-uuokfmhzsa-m
 * molecular-weight:
-** 175.118
+** 344.2
 == Reaction(s) known to consume the compound ==
-* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
-* [[ETHYL-RXN]]
-* [[RXN-12440]]
-* [[RXN-13185]]
-* [[RXN-15598]]
-* [[RXN-19200]]
-* [[RXN-3521]]
-* [[RXN-7984]]
-* [[RXN-7985]]
 == Reaction(s) known to produce the compound ==
-* [[1.3.3.12-RXN]]
+* [[GUANYLCYC-RXN]]
-* [[1.6.5.4-RXN]]
-* [[1.8.5.1-RXN]]
-* [[RXN-11153]]
-* [[RXN-12440]]
-* [[RXN-13185]]
-* [[RXN-13689]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-ascorbate}}
+{{#set: common-name=cyclic-gmp}}
-{{#set: inchi-key=inchikey=ciwbshskhkdkbq-jlaznsocsa-m}}
+{{#set: inchi-key=inchikey=zoogrgpoevqqdx-uuokfmhzsa-m}}
-{{#set: molecular-weight=175.118}}
+{{#set: molecular-weight=344.2}}