Difference between revisions of "PWY0-1415"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * common-name: ** 7,8-dihydrolumazine * smiles: ** c2(=o)(c1(=c(ncc=n1)...")
(Created page with "Category:pathway == Pathway PWY0-1415 == * taxonomic-range: ** tax-2 * common-name: ** superpathway of heme b biosynthesis from uroporphyrinogen-iii == Reaction(s) found =...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] ==
+
== Pathway PWY0-1415 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 7,8-dihydrolumazine
+
** superpathway of heme b biosynthesis from uroporphyrinogen-iii
* smiles:
+
== Reaction(s) found ==
** c2(=o)(c1(=c(ncc=n1)nc(=o)n2))
+
* [[PROTOHEMEFERROCHELAT-RXN]]
* inchi-key:
+
* [[PROTOPORGENOXI-RXN]]
** myjneehzesremo-uhfffaoysa-n
+
* [[RXN0-1461]]
* molecular-weight:
+
* [[UROGENDECARBOX-RXN]]
** 166.139
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
No padmetRef was given during wikipage creation or pathway not in metacyc, data not available
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-2}}
* [[RXN-15261]]
+
{{#set: common-name=superpathway of heme b biosynthesis from uroporphyrinogen-iii}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=4}}
{{#set: common-name=7,8-dihydrolumazine}}
+
{{#set: completion rate=n.a}}
{{#set: inchi-key=inchikey=myjneehzesremo-uhfffaoysa-n}}
+
{{#set: nb total reaction=n.a}}
{{#set: molecular-weight=166.139}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY0-1415

  • taxonomic-range:
    • tax-2
  • common-name:
    • superpathway of heme b biosynthesis from uroporphyrinogen-iii

Reaction(s) found

Reaction(s) not found

No padmetRef was given during wikipage creation or pathway not in metacyc, data not available