Difference between revisions of "PWY0-1415"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oleoyl-lipid Oleoyl-lipid] == * common-name: ** a [glycerolipid]-oleate == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * common-name: ** 7,8-dihydrolumazine * smiles: ** c2(=o)(c1(=c(ncc=n1)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydrolumazine |
| + | * smiles: | ||
| + | ** c2(=o)(c1(=c(ncc=n1)nc(=o)n2)) | ||
| + | * inchi-key: | ||
| + | ** myjneehzesremo-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 166.139 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15261]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydrolumazine}} |
| + | {{#set: inchi-key=inchikey=myjneehzesremo-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=166.139}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-16458
- common-name:
- 7,8-dihydrolumazine
- smiles:
- c2(=o)(c1(=c(ncc=n1)nc(=o)n2))
- inchi-key:
- myjneehzesremo-uhfffaoysa-n
- molecular-weight:
- 166.139
