Difference between revisions of "PWY0-1415"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] ==
+== Pathway DETOX1-PWY-1 ==
+* taxonomic-range:
+** tax-2
+** tax-2157
+** tax-2759
 * common-name:
-** 7,8-dihydrolumazine
+** reactive oxygen species degradation
-* smiles:
+== Reaction(s) found ==
-** c2(=o)(c1(=c(ncc=n1)nc(=o)n2))
+* [[CATAL-RXN]]
-* inchi-key:
+* [[GLUTATHIONE-PEROXIDASE-RXN]]
-** myjneehzesremo-uhfffaoysa-n
+* [[SUPEROX-DISMUT-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 166.139
+* [NoneRXN-12540 RXN-12540]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=reactive oxygen species degradation}}
-* [[RXN-15261]]
+{{#set: nb reaction found=3}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.75}}
-{{#set: common-name=7,8-dihydrolumazine}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=myjneehzesremo-uhfffaoysa-n}}
-{{#set: molecular-weight=166.139}}