Difference between revisions of "PWY0-1433"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=...")
(Created page with "Category:pathway == Pathway PWY0-1433 == * taxonomic-range: ** tax-2 * common-name: ** tetrahydromonapterin biosynthesis == Reaction(s) found == * GTP-CYCLOHYDRO-I-RXN...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] ==
+
== Pathway PWY0-1433 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** ubiquinol-9
+
** tetrahydromonapterin biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+
* [[GTP-CYCLOHYDRO-I-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** npcoqxavbjjzbq-wjnluyjisa-n
+
* [NoneH2NTPEPIM-RXN H2NTPEPIM-RXN]
* molecular-weight:
+
* [NoneRXN0-6367 RXN0-6367]
** 797.255
+
* [NoneRXN0-6368 RXN0-6368]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=tetrahydromonapterin biosynthesis}}
* [[2.1.1.64-RXN]]
+
{{#set: nb reaction found=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.25}}
{{#set: common-name=ubiquinol-9}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}}
 
{{#set: molecular-weight=797.255}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY0-1433

  • taxonomic-range:
    • tax-2
  • common-name:
    • tetrahydromonapterin biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneH2NTPEPIM-RXN H2NTPEPIM-RXN]
  • [NoneRXN0-6367 RXN0-6367]
  • [NoneRXN0-6368 RXN0-6368]