Difference between revisions of "PWY0-1433"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] ==
+== Pathway PWY0-1433 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** ubiquinol-9
+** tetrahydromonapterin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+* [[GTP-CYCLOHYDRO-I-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** npcoqxavbjjzbq-wjnluyjisa-n
+* [NoneRXN0-6368 RXN0-6368]
-* molecular-weight:
+* [NoneH2NTPEPIM-RXN H2NTPEPIM-RXN]
-** 797.255
+* [NoneRXN0-6367 RXN0-6367]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=tetrahydromonapterin biosynthesis}}
-* [[2.1.1.64-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=ubiquinol-9}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}}
-{{#set: molecular-weight=797.255}}