Difference between revisions of "PWY0-1479"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13401 CPD-13401] == * common-name: ** l-alanyl-l-histidine * smiles: ** cc([n+])c(=o)nc(cc1...")
(Created page with "Category:pathway == Pathway PWY0-1479 == * taxonomic-range: ** tax-2 * common-name: ** trna processing == Reaction(s) found == * 3.1.26.5-RXN * RXN0-4222 * RXN0-...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13401 CPD-13401] ==
+
== Pathway PWY0-1479 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** l-alanyl-l-histidine
+
** trna processing
* smiles:
+
== Reaction(s) found ==
** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-]
+
* [[3.1.26.5-RXN]]
* inchi-key:
+
* [[RXN0-4222]]
** xzwxfwbhyrflef-fsplstopsa-n
+
* [[RXN0-6479]]
* molecular-weight:
+
* [[RXN0-6480]]
** 226.235
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN0-6478 RXN0-6478]
* [[RXN0-6978]]
+
* [NoneRXN0-6482 RXN0-6482]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN0-6484 RXN0-6484]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN0-6485 RXN0-6485]
{{#set: common-name=l-alanyl-l-histidine}}
+
* [NoneRXN0-6483 RXN0-6483]
{{#set: inchi-key=inchikey=xzwxfwbhyrflef-fsplstopsa-n}}
+
* [NoneRXN0-6481 RXN0-6481]
{{#set: molecular-weight=226.235}}
+
{{#set: taxonomic-range=tax-2}}
 +
{{#set: common-name=trna processing}}
 +
{{#set: nb reaction found=4}}
 +
{{#set: completion rate=0.4}}
 +
{{#set: nb total reaction=10}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY0-1479

  • taxonomic-range:
    • tax-2
  • common-name:
    • trna processing

Reaction(s) found

Reaction(s) not found

  • [NoneRXN0-6478 RXN0-6478]
  • [NoneRXN0-6482 RXN0-6482]
  • [NoneRXN0-6484 RXN0-6484]
  • [NoneRXN0-6485 RXN0-6485]
  • [NoneRXN0-6483 RXN0-6483]
  • [NoneRXN0-6481 RXN0-6481]