Difference between revisions of "PWY0-1479"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR-tRNAs TYR-tRNAs] == * common-name: ** a trnatyr == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13401 CPD-13401] == * common-name: ** l-alanyl-l-histidine * smiles: ** cc([n+])c(=o)nc(cc1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13401 CPD-13401] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-histidine |
| + | * smiles: | ||
| + | ** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** xzwxfwbhyrflef-fsplstopsa-n | ||
| + | * molecular-weight: | ||
| + | ** 226.235 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6978]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-histidine}} |
| + | {{#set: inchi-key=inchikey=xzwxfwbhyrflef-fsplstopsa-n}} | ||
| + | {{#set: molecular-weight=226.235}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-13401
- common-name:
- l-alanyl-l-histidine
- smiles:
- cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-]
- inchi-key:
- xzwxfwbhyrflef-fsplstopsa-n
- molecular-weight:
- 226.235
