Difference between revisions of "PWY0-1479"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13401 CPD-13401] ==
+== Pathway PWY-7645 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** l-alanyl-l-histidine
+** hyaluronan degradation
-* smiles:
+== Reaction(s) found ==
-** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-]
+* [[RXN-16485]]
-* inchi-key:
+== Reaction(s) not found ==
-** xzwxfwbhyrflef-fsplstopsa-n
+* [NoneHYALURONATE-LYASE-RXN HYALURONATE-LYASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 226.235
+{{#set: common-name=hyaluronan degradation}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN0-6978]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=l-alanyl-l-histidine}}
-{{#set: inchi-key=inchikey=xzwxfwbhyrflef-fsplstopsa-n}}
-{{#set: molecular-weight=226.235}}