Difference between revisions of "PWY0-1507"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] == * common-name: ** menaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8124 CPD-8124] == * common-name: ** thio-molybdenum cofactor * smiles: ** c(op([o-])(=o)[o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8124 CPD-8124] ==
 
* common-name:
 
* common-name:
** menaquinol-12
+
** thio-molybdenum cofactor
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
+
** c(op([o-])(=o)[o-])c2(c1(s[mo](=s)(=o)sc=1[ch]3([ch](o2)nc4(=c(n3)c(=o)nc(n)=n4))))
 
* inchi-key:
 
* inchi-key:
** fwfjgqgpmzxtlm-wppieqshsa-n
+
** qngjrommahoofq-jsudgwjlsa-j
 
* molecular-weight:
 
* molecular-weight:
** 991.617
+
** 535.312
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9363]]
+
* [[RXN-8351]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-12}}
+
{{#set: common-name=thio-molybdenum cofactor}}
{{#set: inchi-key=inchikey=fwfjgqgpmzxtlm-wppieqshsa-n}}
+
{{#set: inchi-key=inchikey=qngjrommahoofq-jsudgwjlsa-j}}
{{#set: molecular-weight=991.617}}
+
{{#set: molecular-weight=535.312}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-8124

  • common-name:
    • thio-molybdenum cofactor
  • smiles:
    • c(op([o-])(=o)[o-])c2(c1(s[mo](=s)(=o)sc=1[ch]3([ch](o2)nc4(=c(n3)c(=o)nc(n)=n4))))
  • inchi-key:
    • qngjrommahoofq-jsudgwjlsa-j
  • molecular-weight:
    • 535.312

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality