Difference between revisions of "PWY0-1517"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-381 CPD-381] ==
+== Pathway PWY0-1517 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
 * common-name:
-** (s)-2-hydroxyglutarate
+** sedoheptulose bisphosphate bypass
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])c(o)ccc(=o)[o-]
+* [[SEDOBISALDOL-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** hwxbtnavrsuojr-vkhmyheasa-l
+* [NoneRXN0-6541 RXN0-6541]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2|tax-2759}}
-** 146.099
+{{#set: common-name=sedoheptulose bisphosphate bypass}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
+{{#set: completion rate=0.5}}
-* [[RXN-16701]]
+{{#set: nb total reaction=2}}
-== Reaction(s) known to produce the compound ==
-* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
-* [[RXN-16701]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-2-hydroxyglutarate}}
-{{#set: inchi-key=inchikey=hwxbtnavrsuojr-vkhmyheasa-l}}
-{{#set: molecular-weight=146.099}}