Difference between revisions of "PWY0-1534"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1308 CPD0-1308] == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o *...") |
(Created page with "Category:pathway == Pathway PWY0-1534 == * taxonomic-range: ** tax-2 * common-name: ** hydrogen sulfide biosynthesis i == Reaction(s) found == * CYSTEINE-AMINOTRANSFERAS...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY0-1534 == |
+ | * taxonomic-range: | ||
+ | ** tax-2 | ||
* common-name: | * common-name: | ||
− | ** | + | ** hydrogen sulfide biosynthesis i |
− | + | == Reaction(s) found == | |
− | + | * [[CYSTEINE-AMINOTRANSFERASE-RXN]] | |
− | + | == Reaction(s) not found == | |
− | + | No padmetRef was given during wikipage creation or pathway not in metacyc, data not available | |
− | + | {{#set: taxonomic-range=tax-2}} | |
− | + | {{#set: common-name=hydrogen sulfide biosynthesis i}} | |
− | == Reaction(s) | + | {{#set: nb reaction found=1}} |
− | * [[RXN | + | {{#set: completion rate=n.a}} |
− | == Reaction(s) | + | {{#set: nb total reaction=n.a}} |
− | = | ||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 10:57, 18 March 2021
Pathway PWY0-1534
- taxonomic-range:
- tax-2
- common-name:
- hydrogen sulfide biosynthesis i
Reaction(s) found
Reaction(s) not found
No padmetRef was given during wikipage creation or pathway not in metacyc, data not available