Difference between revisions of "PWY0-1535"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4207 CPD-4207] ==
+== Pathway PWY0-1535 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
 * common-name:
-** isopentenyl adenosine
+** d-serine degradation
-* smiles:
+== Reaction(s) found ==
-** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
+* [[RXN-15581]]
-* inchi-key:
+== Reaction(s) not found ==
-** usvmjsalorzvdv-sdbhatresa-n
+* [NoneRXN-15127 RXN-15127]
-* molecular-weight:
+* [NoneRXN-15124 RXN-15124]
-** 335.362
+{{#set: taxonomic-range=tax-2|tax-2759}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=d-serine degradation}}
-* [[RXN-4315]]
+{{#set: nb reaction found=1}}
-* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
+{{#set: completion rate=0.33}}
-* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
+{{#set: nb total reaction=3}}
-== Reaction(s) known to produce the compound ==
-* [[RXN-4315]]
-* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
-* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=isopentenyl adenosine}}
-{{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}}
-{{#set: molecular-weight=335.362}}