Difference between revisions of "PWY0-1544"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXY-D-GLUCOSE-6-PHOSPHATE 2-DEOXY-D-GLUCOSE-6-PHOSPHATE] ==
+== Pathway PWY0-1544 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
 * common-name:
-** 2-deoxy-d-glucose 6-phosphate
+** proline to cytochrome bo oxidase electron transfer
-* smiles:
+== Reaction(s) found ==
-** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
+* [[RXN0-7008]]
-* inchi-key:
+== Reaction(s) not found ==
-** uqjfzaagzayvkz-cermhhmhsa-l
+* [NoneRXN0-5268 RXN0-5268]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2|tax-2157}}
-** 242.122
+{{#set: common-name=proline to cytochrome bo oxidase electron transfer}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[3.1.3.68-RXN]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=2-deoxy-d-glucose 6-phosphate}}
-{{#set: inchi-key=inchikey=uqjfzaagzayvkz-cermhhmhsa-l}}
-{{#set: molecular-weight=242.122}}