Difference between revisions of "PWY0-1544"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXY-D-GLUCOSE-6-PHOSPHATE 2-DEOXY-D-GLUCOSE-6-PHOSPHATE] == * common-name: ** 2-deoxy-d-glu...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * common-name: ** zymosterone * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXY-D-GLUCOSE-6-PHOSPHATE 2-DEOXY-D-GLUCOSE-6-PHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] ==
 
* common-name:
 
* common-name:
** 2-deoxy-d-glucose 6-phosphate
+
** zymosterone
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
+
** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(=o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** uqjfzaagzayvkz-cermhhmhsa-l
+
** aunlirxijavbnm-zsbatxslsa-n
 
* molecular-weight:
 
* molecular-weight:
** 242.122
+
** 382.628
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.68-RXN]]
+
* [[RXN66-319]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-318]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-deoxy-d-glucose 6-phosphate}}
+
{{#set: common-name=zymosterone}}
{{#set: inchi-key=inchikey=uqjfzaagzayvkz-cermhhmhsa-l}}
+
{{#set: inchi-key=inchikey=aunlirxijavbnm-zsbatxslsa-n}}
{{#set: molecular-weight=242.122}}
+
{{#set: molecular-weight=382.628}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-4581

  • common-name:
    • zymosterone
  • smiles:
    • cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(=o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • aunlirxijavbnm-zsbatxslsa-n
  • molecular-weight:
    • 382.628

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality