Difference between revisions of "PWY0-1545"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] == * common-name: ** 5',5'''-dia...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-L-arginines Histone-L-arginines] == * common-name: ** [histone]-l-arginine == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-L-arginines Histone-L-arginines] ==
 
* common-name:
 
* common-name:
** 5',5'''-diadenosine triphosphate
+
** [histone]-l-arginine
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])op(=o)([o-])op(=o)([o-])occ6(c(c(c(n5(c4(=c(c(=nc=n4)n)n=c5)))o6)o)o)
 
* inchi-key:
 
** qcicupzzliqapa-xpwfqurosa-k
 
* molecular-weight:
 
** 753.388
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
+
* [[2.1.1.125-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5',5'''-diadenosine triphosphate}}
+
{{#set: common-name=[histone]-l-arginine}}
{{#set: inchi-key=inchikey=qcicupzzliqapa-xpwfqurosa-k}}
 
{{#set: molecular-weight=753.388}}
 

Revision as of 14:19, 26 August 2019

Metabolite Histone-L-arginines

  • common-name:
    • [histone]-l-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "histone]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.