Difference between revisions of "PWY0-1546"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12019 CPD-12019] == * common-name: ** 5-methoxyindoleacetaldehyde * smiles: ** coc2(c=cc1(=...")
(Created page with "Category:pathway == Pathway PWY0-1546 == * taxonomic-range: ** tax-2 * common-name: ** muropeptide degradation == Reaction(s) found == * RXN0-6981 == Reaction(s) not f...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12019 CPD-12019] ==
+
== Pathway PWY0-1546 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 5-methoxyindoleacetaldehyde
+
** muropeptide degradation
* smiles:
+
== Reaction(s) found ==
** coc2(c=cc1(=c(c(cc=o)=cn1)c=2))
+
* [[RXN0-6981]]
* inchi-key:
+
== Reaction(s) not found ==
** xvhhcgdxcdkklh-uhfffaoysa-n
+
* [NoneRXN0-5227 RXN0-5227]
* molecular-weight:
+
* [NoneRXN0-961 RXN0-961]
** 189.213
+
* [NoneRXN0-5228 RXN0-5228]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=muropeptide degradation}}
* [[RXN-11067]]
+
{{#set: nb reaction found=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.25}}
{{#set: common-name=5-methoxyindoleacetaldehyde}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=xvhhcgdxcdkklh-uhfffaoysa-n}}
 
{{#set: molecular-weight=189.213}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY0-1546

  • taxonomic-range:
    • tax-2
  • common-name:
    • muropeptide degradation

Reaction(s) found

Reaction(s) not found

  • [NoneRXN0-5227 RXN0-5227]
  • [NoneRXN0-961 RXN0-961]
  • [NoneRXN0-5228 RXN0-5228]