Difference between revisions of "PWY0-1546"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12019 CPD-12019] == * common-name: ** 5-methoxyindoleacetaldehyde * smiles: ** coc2(c=cc1(=...")
(Created page with "Category:pathway == Pathway PWY-7725 == * taxonomic-range: ** tax-2759 * common-name: ** arachidonate biosynthesis v (8-detaturase, mammals) == Reaction(s) found == * RX...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12019 CPD-12019] ==
+
== Pathway PWY-7725 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** 5-methoxyindoleacetaldehyde
+
** arachidonate biosynthesis v (8-detaturase, mammals)
* smiles:
+
== Reaction(s) found ==
** coc2(c=cc1(=c(c(cc=o)=cn1)c=2))
+
* [[RXN-16094]]
* inchi-key:
+
* [[RXN-16095]]
** xvhhcgdxcdkklh-uhfffaoysa-n
+
* [[RXN-16096]]
* molecular-weight:
+
* [[RXN-16097]]
** 189.213
+
* [[RXN-17105]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-16064 RXN-16064]
* [[RXN-11067]]
+
{{#set: taxonomic-range=tax-2759}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=arachidonate biosynthesis v (8-detaturase, mammals)}}
{{#set: common-name=5-methoxyindoleacetaldehyde}}
+
{{#set: nb reaction found=5}}
{{#set: inchi-key=inchikey=xvhhcgdxcdkklh-uhfffaoysa-n}}
+
{{#set: completion rate=0.83}}
{{#set: molecular-weight=189.213}}
+
{{#set: nb total reaction=6}}

Revision as of 20:17, 18 December 2020

Pathway PWY-7725

  • taxonomic-range:
    • tax-2759
  • common-name:
    • arachidonate biosynthesis v (8-detaturase, mammals)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16064 RXN-16064]