Difference between revisions of "PWY0-1561"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] ==
+== Pathway PWY0-1561 ==
+* taxonomic-range:
+** tax-2
+** tax-2157
 * common-name:
-** n&omega;-hydroxy-l-arginine
+** glycerol-3-phosphate to cytochrome bo oxidase electron transfer
-* smiles:
+== Reaction(s) found ==
-** c(nc(no)=[n+])ccc([n+])c([o-])=o
+* [[RXN0-5260]]
-* inchi-key:
+== Reaction(s) not found ==
-** fqwravymzulpnk-bypyzucnsa-o
+* [NoneRXN0-5268 RXN0-5268]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2|tax-2157}}
-** 191.209
+{{#set: common-name=glycerol-3-phosphate to cytochrome bo oxidase electron transfer}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-13565]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[RXN-13564]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=n&omega;-hydroxy-l-arginine}}
-{{#set: inchi-key=inchikey=fqwravymzulpnk-bypyzucnsa-o}}
-{{#set: molecular-weight=191.209}}