Difference between revisions of "PWY0-1561"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] == * common-name: ** utp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc...")
(Created page with "Category:pathway == Pathway PWY-6087 == * taxonomic-range: ** tax-2 * common-name: ** 4-chlorocatechol degradation == Reaction(s) found == * CARBOXYMETHYLENEBUTENOLIDASE...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] ==
+
== Pathway PWY-6087 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** utp
+
** 4-chlorocatechol degradation
* smiles:
+
== Reaction(s) found ==
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** pgavkcovuiysfo-xvfcmesisa-j
+
* [NoneMALEYLACETATE-REDUCTASE-RXN MALEYLACETATE-REDUCTASE-RXN]
* molecular-weight:
+
* [NoneRXN-9893 RXN-9893]
** 480.112
+
* [NoneRXN-9892 RXN-9892]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-9870 RXN-9870]
* [[2.7.7.11-RXN]]
+
{{#set: taxonomic-range=tax-2}}
* [[2.7.7.44-RXN]]
+
{{#set: common-name=4-chlorocatechol degradation}}
* [[2.7.7.64-RXN]]
+
{{#set: nb reaction found=1}}
* [[CTPSYN-RXN]]
+
{{#set: completion rate=0.2}}
* [[GLUC1PURIDYLTRANS-RXN]]
+
{{#set: nb total reaction=5}}
* [[NAG1P-URIDYLTRANS-RXN]]
 
* [[R00157]]
 
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 
* [[RXN-12196]]
 
* [[RXN-12199]]
 
* [[RXN-13760]]
 
* [[RXN-14139]]
 
* [[RXN-14325]]
 
* [[RXN0-724]]
 
* [[UG1PUT]]
 
* [[UTCY]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
* [[UTPPH]]
 
* [[UTUP]]
 
== Reaction(s) known to produce the compound ==
 
* [[2.7.7.11-RXN]]
 
* [[2.7.7.44-RXN]]
 
* [[2.7.7.64-RXN]]
 
* [[ATUD]]
 
* [[ATUDm]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[R00157]]
 
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 
* [[RXN-13760]]
 
* [[UDPKIN-RXN]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=utp}}
 
{{#set: inchi-key=inchikey=pgavkcovuiysfo-xvfcmesisa-j}}
 
{{#set: molecular-weight=480.112}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-6087

  • taxonomic-range:
    • tax-2
  • common-name:
    • 4-chlorocatechol degradation

Reaction(s) found

Reaction(s) not found

  • [NoneMALEYLACETATE-REDUCTASE-RXN MALEYLACETATE-REDUCTASE-RXN]
  • [NoneRXN-9893 RXN-9893]
  • [NoneRXN-9892 RXN-9892]
  • [NoneRXN-9870 RXN-9870]