Difference between revisions of "PWY0-1561"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] == * common-name: ** utp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] ==
 
* common-name:
 
* common-name:
** nω-hydroxy-l-arginine
+
** utp
 
* smiles:
 
* smiles:
** c(nc(no)=[n+])ccc([n+])c([o-])=o
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
* inchi-key:
** fqwravymzulpnk-bypyzucnsa-o
+
** pgavkcovuiysfo-xvfcmesisa-j
 
* molecular-weight:
 
* molecular-weight:
** 191.209
+
** 480.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13565]]
+
* [[2.7.7.11-RXN]]
 +
* [[2.7.7.44-RXN]]
 +
* [[2.7.7.64-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[NAG1P-URIDYLTRANS-RXN]]
 +
* [[R00157]]
 +
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 +
* [[RXN-12196]]
 +
* [[RXN-12199]]
 +
* [[RXN-13760]]
 +
* [[RXN-14139]]
 +
* [[RXN-14325]]
 +
* [[RXN0-724]]
 +
* [[UG1PUT]]
 +
* [[UTCY]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
* [[UTPPH]]
 +
* [[UTUP]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13564]]
+
* [[2.7.7.11-RXN]]
 +
* [[2.7.7.44-RXN]]
 +
* [[2.7.7.64-RXN]]
 +
* [[ATUD]]
 +
* [[ATUDm]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[R00157]]
 +
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 +
* [[RXN-13760]]
 +
* [[UDPKIN-RXN]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nω-hydroxy-l-arginine}}
+
{{#set: common-name=utp}}
{{#set: inchi-key=inchikey=fqwravymzulpnk-bypyzucnsa-o}}
+
{{#set: inchi-key=inchikey=pgavkcovuiysfo-xvfcmesisa-j}}
{{#set: molecular-weight=191.209}}
+
{{#set: molecular-weight=480.112}}

Revision as of 09:22, 27 August 2019

Metabolite UTP

  • common-name:
    • utp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • pgavkcovuiysfo-xvfcmesisa-j
  • molecular-weight:
    • 480.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality