Difference between revisions of "PWY0-1573"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * smiles: ** c(op(=o)(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * common-name: ** 4-prenylphlorisovalerophenone * smiles: ** cc(=ccc1(=c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-prenylphlorisovalerophenone |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lwlgkghhvbvdkb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 277.339 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7810]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7811]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-prenylphlorisovalerophenone}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lwlgkghhvbvdkb-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=277.339}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-7109
- common-name:
- 4-prenylphlorisovalerophenone
- smiles:
- cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c
- inchi-key:
- lwlgkghhvbvdkb-uhfffaoysa-m
- molecular-weight:
- 277.339