Difference between revisions of "PWY0-1573"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] == * common-name: ** antheraxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * smiles: ** c(op(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] ==
 
* common-name:
 
* common-name:
** antheraxanthin
+
** 5-phospho-α-d-ribose 1-diphosphate
 
* smiles:
 
* smiles:
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
+
** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** ofnsuwbaqrchav-oyquvcaxsa-n
+
** pqgcedqwhsbajp-txicztdvsa-i
 
* molecular-weight:
 
* molecular-weight:
** 584.881
+
** 385.031
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7979]]
+
* [[ADENPRIBOSYLTRAN-RXN]]
* [[RXN-7985]]
+
* [[ADPART]]
 +
* [[APPRT]]
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[GUANPRIBOSYLTRAN-RXN]]
 +
* [[HPRT]]
 +
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 +
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 +
* [[OROPRIBTRANS-RXN]]
 +
* [[ORPRT]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[PRTRANS-RXN]]
 +
* [[QUINOPRIBOTRANS-RXN]]
 +
* [[RPDPK]]
 +
* [[RXN-14270]]
 +
* [[URACIL-PRIBOSYLTRANS-RXN]]
 +
* [[XPPRT]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7978]]
+
* [[APPRT]]
* [[RXN-7984]]
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[GUANPRIBOSYLTRAN-RXN]]
 +
* [[HPRT]]
 +
* [[OROPRIBTRANS-RXN]]
 +
* [[ORPRT]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[PRTRANS-RXN]]
 +
* [[R5PDP]]
 +
* [[RPDPK]]
 +
* [[XPPRT]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=antheraxanthin}}
+
{{#set: common-name=5-phospho-α-d-ribose 1-diphosphate}}
{{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}}
+
{{#set: inchi-key=inchikey=pqgcedqwhsbajp-txicztdvsa-i}}
{{#set: molecular-weight=584.881}}
+
{{#set: molecular-weight=385.031}}

Revision as of 14:18, 26 August 2019

Metabolite PRPP

  • common-name:
    • 5-phospho-α-d-ribose 1-diphosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
  • inchi-key:
    • pqgcedqwhsbajp-txicztdvsa-i
  • molecular-weight:
    • 385.031

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality