Difference between revisions of "PWY0-1582"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+...")
(Created page with "Category:pathway == Pathway PWY-2161 == * taxonomic-range: ** tax-2759 ** tax-2 ** tax-2157 * common-name: ** folate polyglutamylation == Reaction(s) found == * FOLYLPOL...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] ==
+
== Pathway PWY-2161 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 +
** tax-2157
 
* common-name:
 
* common-name:
** l-ornithine
+
** folate polyglutamylation
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])c([n+])ccc[n+]
+
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
* inchi-key:
+
* [[FORMATETHFLIG-RXN]]
** ahlphdhhmvztml-bypyzucnsa-o
+
* [[FORMYLTHFGLUSYNTH-RXN]]
* molecular-weight:
+
* [[GLYOHMETRANS-RXN]]
** 133.17
+
* [[RXN0-2921]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
* [[ACETYLORNDEACET-RXN]]
+
All reactions of this pathways are in present
* [[ARGINASE-RXN]]
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
* [[ORDC]]
+
{{#set: common-name=folate polyglutamylation}}
* [[ORNCARBAMTRANSFER-RXN]]
+
{{#set: nb reaction found=5}}
* [[ORNDECARBOX-RXN]]
+
{{#set: completion rate=1.0}}
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+
{{#set: nb total reaction=5}}
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
 
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
* [[RXN-13482]]
 
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
* [[ACETYLORNDEACET-RXN]]
 
* [[AODAA]]
 
* [[ARGINASE-RXN]]
 
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
* [[RXN-13482]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=l-ornithine}}
 
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
 
{{#set: molecular-weight=133.17}}
 

Revision as of 20:17, 18 December 2020

Pathway PWY-2161

  • taxonomic-range:
    • tax-2759
    • tax-2
    • tax-2157
  • common-name:
    • folate polyglutamylation

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present