Difference between revisions of "PWY0-1582"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylgua-26-Gua27 tRNA-Containing-N2-Methylgua-26-Gua27] == * common-name:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylgua-26-Gua27 tRNA-Containing-N2-Methylgua-26-Gua27] == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n2-methylguanine26/guanine27 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12379]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12378]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n2-methylguanine26/guanine27 in trna}} |
| − | |||
| − | |||
Revision as of 14:19, 26 August 2019
Contents
Metabolite tRNA-Containing-N2-Methylgua-26-Gua27
- common-name:
- an n2-methylguanine26/guanine27 in trna
