Difference between revisions of "PWY0-1582"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylgua-26-Gua27 tRNA-Containing-N2-Methylgua-26-Gua27] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] ==
 * common-name:
-** an n2-methylguanine26/guanine27 in trna
+** l-ornithine
+* smiles:
+** c(=o)([o-])c([n+])ccc[n+]
+* inchi-key:
+** ahlphdhhmvztml-bypyzucnsa-o
+* molecular-weight:
+** 133.17
 == Reaction(s) known to consume the compound ==
-* [[RXN-12379]]
+* [[ACETYLORNDEACET-RXN]]
+* [[ARGINASE-RXN]]
+* [[ORDC]]
+* [[ORNCARBAMTRANSFER-RXN]]
+* [[ORNDECARBOX-RXN]]
+* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+* [[ORNITHINE-CYCLODEAMINASE-RXN]]
+* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
+* [[RXN-13482]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-12378]]
+* [[ACETYLORNDEACET-RXN]]
+* [[AODAA]]
+* [[ARGINASE-RXN]]
+* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+* [[ORNCARBAMTRANSFER-RXN]]
+* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
+* [[RXN-13482]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=an n2-methylguanine26/guanine27 in trna}}
+{{#set: common-name=l-ornithine}}
+{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
+{{#set: molecular-weight=133.17}}