Difference between revisions of "PWY0-1587"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=K-HEXANOYL-COA K-HEXANOYL-COA] == * common-name: ** 3-oxohexanoyl-coa * smiles: ** cccc(cc(sccn...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=K-HEXANOYL-COA K-HEXANOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] ==
 
* common-name:
 
* common-name:
** 3-oxohexanoyl-coa
+
** dutp
 
* smiles:
 
* smiles:
** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
+
** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** nfoyyxqavvywkv-hdrqghtbsa-j
+
** ahcymluzirlxaa-shyzeuofsa-j
 
* molecular-weight:
 
* molecular-weight:
** 875.63
+
** 464.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HACD2h]]
+
* [[DUTCP]]
* [[RXN-12570]]
+
* [[DUTNH]]
 +
* [[DUTP-PYROP-RXN]]
 +
* [[DUTUP]]
 +
* [[RXN-14199]]
 +
* [[RXN-14219]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACACT2h]]
+
* [[ATDUD]]
* [[HACD2h]]
+
* [[ATDUDm]]
* [[RXN-12565]]
+
* [[DUDPKIN-RXN]]
 +
* [[RXN0-724]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxohexanoyl-coa}}
+
{{#set: common-name=dutp}}
{{#set: inchi-key=inchikey=nfoyyxqavvywkv-hdrqghtbsa-j}}
+
{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
{{#set: molecular-weight=875.63}}
+
{{#set: molecular-weight=464.112}}

Revision as of 14:19, 26 August 2019

Metabolite DUTP

  • common-name:
    • dutp
  • smiles:
    • c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
  • inchi-key:
    • ahcymluzirlxaa-shyzeuofsa-j
  • molecular-weight:
    • 464.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality