Difference between revisions of "PWY0-166"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18447 CPD-18447] == * common-name: ** actinocin * smiles: ** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITHIOTHREITOL DITHIOTHREITOL] == * common-name: ** l-dithiothreitol * smiles: ** c(s)c(o)c(o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18447 CPD-18447] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITHIOTHREITOL DITHIOTHREITOL] ==
 
* common-name:
 
* common-name:
** actinocin
+
** l-dithiothreitol
 
* smiles:
 
* smiles:
** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3)))
+
** c(s)c(o)c(o)cs
 
* inchi-key:
 
* inchi-key:
** kxrmrepjuitwdu-uhfffaoysa-l
+
** vhjlvaabsrfdpm-imjsidkusa-n
 
* molecular-weight:
 
* molecular-weight:
** 326.265
+
** 154.242
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17077]]
+
* [[1.1.4.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17077]]
+
* [[1.1.4.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=actinocin}}
+
{{#set: common-name=l-dithiothreitol}}
{{#set: inchi-key=inchikey=kxrmrepjuitwdu-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=vhjlvaabsrfdpm-imjsidkusa-n}}
{{#set: molecular-weight=326.265}}
+
{{#set: molecular-weight=154.242}}

Revision as of 09:22, 27 August 2019

Metabolite DITHIOTHREITOL

  • common-name:
    • l-dithiothreitol
  • smiles:
    • c(s)c(o)c(o)cs
  • inchi-key:
    • vhjlvaabsrfdpm-imjsidkusa-n
  • molecular-weight:
    • 154.242

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality